C25H29NO2 — CID 54802599
N-[2-(2,5-dimethylphenoxy)propyl]-3-(2-phenylethoxy)aniline (PubChem CID 54802599) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[2-(2,5-dimethylphenoxy)propyl]-3-(2-phenylethoxy)aniline.
| Compound Name | N-[2-(2,5-dimethylphenoxy)propyl]-3-(2-phenylethoxy)aniline |
|---|---|
| PubChem CID | 54802599 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[2-(2,5-dimethylphenoxy)propyl]-3-(2-phenylethoxy)aniline |
| SMILES | Cc1ccc(C)c(OC(C)CNc2cccc(OCCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H29NO2/c1-19-12-13-20(2)25(16-19)28-21(3)18-26-23-10-7-11-24(17-23)27-15-14-22-8-5-4-6-9-22/h4-13,16-17,21,26H,14-15,18H2,1-3H3 |
| InChIKey | CEOZKMOTMGOYTQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |