C19H31NO2 — CID 54805012
1-cyclopropyl-N-[(2,4-dibutoxyphenyl)methyl]methanamine (PubChem CID 54805012) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(2,4-dibutoxyphenyl)methyl]methanamine.
| Compound Name | 1-cyclopropyl-N-[(2,4-dibutoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 54805012 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 1-cyclopropyl-N-[(2,4-dibutoxyphenyl)methyl]methanamine |
| SMILES | CCCCOc1ccc(CNCC2CC2)c(OCCCC)c1 |
| InChI | InChI=1S/C19H31NO2/c1-3-5-11-21-18-10-9-17(15-20-14-16-7-8-16)19(13-18)22-12-6-4-2/h9-10,13,16,20H,3-8,11-12,14-15H2,1-2H3 |
| InChIKey | IZPPRWPOWRTXPS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|