C19H25ClN2O — CID 54805537
N-(4-chlorophenyl)-N'-[3-(3-methylbutoxy)phenyl]ethane-1,2-diamine (PubChem CID 54805537) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-[3-(3-methylbutoxy)phenyl]ethane-1,2-diamine.
| Compound Name | N-(4-chlorophenyl)-N'-[3-(3-methylbutoxy)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54805537 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(4-chlorophenyl)-N'-[3-(3-methylbutoxy)phenyl]ethane-1,2-diamine |
| SMILES | CC(C)CCOc1cccc(NCCNc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H25ClN2O/c1-15(2)10-13-23-19-5-3-4-18(14-19)22-12-11-21-17-8-6-16(20)7-9-17/h3-9,14-15,21-22H,10-13H2,1-2H3 |
| InChIKey | HJTXFTHRRIIJGE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|