C22H32N2O — CID 54808232
N-[3-(3-methylbutoxy)phenyl]-N'-(1-phenylpropyl)ethane-1,2-diamine (PubChem CID 54808232) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is N-[3-(3-methylbutoxy)phenyl]-N'-(1-phenylpropyl)ethane-1,2-diamine.
| Compound Name | N-[3-(3-methylbutoxy)phenyl]-N'-(1-phenylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54808232 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | N-[3-(3-methylbutoxy)phenyl]-N'-(1-phenylpropyl)ethane-1,2-diamine |
| SMILES | CCC(NCCNc1cccc(OCCC(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O/c1-4-22(19-9-6-5-7-10-19)24-15-14-23-20-11-8-12-21(17-20)25-16-13-18(2)3/h5-12,17-18,22-24H,4,13-16H2,1-3H3 |
| InChIKey | KUSWVEMLRIZILS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|