C13H18ClFN2O — CID 54809567
N'-(3-chloro-4-fluorophenyl)-N-(oxolan-2-ylmethyl)ethane-1,2-diamine (PubChem CID 54809567) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-(oxolan-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-(oxolan-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809567 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-(oxolan-2-ylmethyl)ethane-1,2-diamine |
| SMILES | Fc1ccc(NCCNCC2CCCO2)cc1Cl |
| InChI | InChI=1S/C13H18ClFN2O/c14-12-8-10(3-4-13(12)15)17-6-5-16-9-11-2-1-7-18-11/h3-4,8,11,16-17H,1-2,5-7,9H2 |
| InChIKey | QBCSZPWODQAMTP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|