C18H20N4O3 — CID 54811372
3-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]benzamide (PubChem CID 54811372) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]benzamide.
| Compound Name | 3-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54811372 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[[2-[4-[acetyl(methyl)amino]anilino]acetyl]amino]benzamide |
| SMILES | CC(=O)N(C)c1ccc(NCC(=O)Nc2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C18H20N4O3/c1-12(23)22(2)16-8-6-14(7-9-16)20-11-17(24)21-15-5-3-4-13(10-15)18(19)25/h3-10,20H,11H2,1-2H3,(H2,19,25)(H,21,24) |
| InChIKey | CGYYNIRQEWVLQK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |