C20H26N2O2 — CID 54811586
2-(2,4-dimethylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]acetamide (PubChem CID 54811586) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]acetamide.
| Compound Name | 2-(2,4-dimethylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54811586 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]acetamide |
| SMILES | Cc1ccc(NCC(=O)NCc2ccc(OC(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C20H26N2O2/c1-14(2)24-18-8-6-17(7-9-18)12-22-20(23)13-21-19-10-5-15(3)11-16(19)4/h5-11,14,21H,12-13H2,1-4H3,(H,22,23) |
| InChIKey | VYEZZNNYLHQVCN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |