C20H27N3O3 — CID 54814790
N-[3-[[2-(heptylamino)acetyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54814790) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[3-[[2-(heptylamino)acetyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-(heptylamino)acetyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54814790 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[3-[[2-(heptylamino)acetyl]amino]phenyl]furan-2-carboxamide |
| SMILES | CCCCCCCNCC(=O)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-2-3-4-5-6-12-21-15-19(24)22-16-9-7-10-17(14-16)23-20(25)18-11-8-13-26-18/h7-11,13-14,21H,2-6,12,15H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | CBSZMRIIGVXFFI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|