C14H28N2O — CID 54816383
2-(cyclohexylamino)-N,N-dipropylacetamide (PubChem CID 54816383) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N,N-dipropylacetamide.
| Compound Name | 2-(cyclohexylamino)-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 54816383 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-(cyclohexylamino)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CNC1CCCCC1 |
| InChI | InChI=1S/C14H28N2O/c1-3-10-16(11-4-2)14(17)12-15-13-8-6-5-7-9-13/h13,15H,3-12H2,1-2H3 |
| InChIKey | PNDLAFCCUMPNKG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |