C13H26N2O — CID 43236917
2-(cycloheptylamino)-N,N-diethylacetamide (PubChem CID 43236917) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-(cycloheptylamino)-N,N-diethylacetamide.
| Compound Name | 2-(cycloheptylamino)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 43236917 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2-(cycloheptylamino)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNC1CCCCCC1 |
| InChI | InChI=1S/C13H26N2O/c1-3-15(4-2)13(16)11-14-12-9-7-5-6-8-10-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | JONVTCFFLWITJR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |