C14H28N2O — CID 113253458
2-(cycloheptylmethylamino)-N,N-diethylacetamide (PubChem CID 113253458) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(cycloheptylmethylamino)-N,N-diethylacetamide.
| Compound Name | 2-(cycloheptylmethylamino)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 113253458 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-(cycloheptylmethylamino)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNCC1CCCCCC1 |
| InChI | InChI=1S/C14H28N2O/c1-3-16(4-2)14(17)12-15-11-13-9-7-5-6-8-10-13/h13,15H,3-12H2,1-2H3 |
| InChIKey | WWTYTHVTQAYZOF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |