C13H24F2N2O — CID 114223910
2-[(3,3-difluorocyclohexyl)methylamino]-N,N-diethylacetamide (PubChem CID 114223910) has the molecular formula C13H24F2N2O and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclohexyl)methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(3,3-difluorocyclohexyl)methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 114223910 |
| Molecular Formula | C13H24F2N2O |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-[(3,3-difluorocyclohexyl)methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNCC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H24F2N2O/c1-3-17(4-2)12(18)10-16-9-11-6-5-7-13(14,15)8-11/h11,16H,3-10H2,1-2H3 |
| InChIKey | UQDRTVCDOFYGGM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |