C14H28F2N2 — CID 114223711
N-[(3,3-difluorocyclohexyl)methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 114223711) has the molecular formula C14H28F2N2 and a molecular weight of 262.39 g/mol. Its IUPAC name is N-[(3,3-difluorocyclohexyl)methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(3,3-difluorocyclohexyl)methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114223711 |
| Molecular Formula | C14H28F2N2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N-[(3,3-difluorocyclohexyl)methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H28F2N2/c1-3-18(4-2)10-6-9-17-12-13-7-5-8-14(15,16)11-13/h13,17H,3-12H2,1-2H3 |
| InChIKey | WYGCEJUWPHCLQU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|