C13H26F2N2 — CID 114224166
N'-[(3,3-difluorocyclohexyl)methyl]-N,N'-diethylethane-1,2-diamine (PubChem CID 114224166) has the molecular formula C13H26F2N2 and a molecular weight of 248.36 g/mol. Its IUPAC name is N'-[(3,3-difluorocyclohexyl)methyl]-N,N'-diethylethane-1,2-diamine.
| Compound Name | N'-[(3,3-difluorocyclohexyl)methyl]-N,N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 114224166 |
| Molecular Formula | C13H26F2N2 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | N'-[(3,3-difluorocyclohexyl)methyl]-N,N'-diethylethane-1,2-diamine |
| SMILES | CCNCCN(CC)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H26F2N2/c1-3-16-8-9-17(4-2)11-12-6-5-7-13(14,15)10-12/h12,16H,3-11H2,1-2H3 |
| InChIKey | IWNNOCAVYJFYRB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|