C18H31NO6 — CID 548165
[3-tert-butyl-7a-(2-hydroxypropan-2-yl)-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl] 3-hydroxy-3-methylbutanoate (PubChem CID 548165) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is [3-tert-butyl-7a-(2-hydroxypropan-2-yl)-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl] 3-hydroxy-3-methylbutanoate.
| Compound Name | [3-tert-butyl-7a-(2-hydroxypropan-2-yl)-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl] 3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 548165 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [3-tert-butyl-7a-(2-hydroxypropan-2-yl)-1-oxo-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-yl] 3-hydroxy-3-methylbutanoate |
| SMILES | CC(C)(O)CC(=O)OC1CN2C(C(C)(C)C)OC(=O)C2(C(C)(C)O)C1 |
| InChI | InChI=1S/C18H31NO6/c1-15(2,3)13-19-10-11(24-12(20)9-16(4,5)22)8-18(19,14(21)25-13)17(6,7)23/h11,13,22-23H,8-10H2,1-7H3 |
| InChIKey | VBEJQAMJWPUOTR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |