C28H31NO12 — CID 548174
hexamethyl 1-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,10-tetraene-12,13,14,15,16,17-hexacarboxylate (PubChem CID 548174) has the molecular formula C28H31NO12 and a molecular weight of 573.55 g/mol. Its IUPAC name is hexamethyl 1-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,10-tetraene-12,13,14,15,16,17-hexacarboxylate.
| Compound Name | hexamethyl 1-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,10-tetraene-12,13,14,15,16,17-hexacarboxylate |
|---|---|
| PubChem CID | 548174 |
| Molecular Formula | C28H31NO12 |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | hexamethyl 1-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,10-tetraene-12,13,14,15,16,17-hexacarboxylate |
| SMILES | COC(=O)C1C2=C3CCc4ccccc4N3C(C(=O)OC)C(C(=O)OC)C2(C(=O)OC)C(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C28H31NO12/c1-36-22(30)16-17(23(31)37-2)19(24(32)38-3)28(27(35)41-6)18(16)15-12-11-13-9-7-8-10-14(13)29(15)21(26(34)40-5)20(28)25(33)39-4/h7-10,16-17,19-21H,11-12H2,1-6H3 |
| InChIKey | WOGWTNKWPKPTKD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|