C15H25N3O4 — CID 54818437
2-methylpropyl 2-[3-oxo-1-[2-(prop-2-enylamino)acetyl]piperazin-2-yl]acetate (PubChem CID 54818437) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-methylpropyl 2-[3-oxo-1-[2-(prop-2-enylamino)acetyl]piperazin-2-yl]acetate.
| Compound Name | 2-methylpropyl 2-[3-oxo-1-[2-(prop-2-enylamino)acetyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54818437 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-methylpropyl 2-[3-oxo-1-[2-(prop-2-enylamino)acetyl]piperazin-2-yl]acetate |
| SMILES | C=CCNCC(=O)N1CCNC(=O)C1CC(=O)OCC(C)C |
| InChI | InChI=1S/C15H25N3O4/c1-4-5-16-9-13(19)18-7-6-17-15(21)12(18)8-14(20)22-10-11(2)3/h4,11-12,16H,1,5-10H2,2-3H3,(H,17,21) |
| InChIKey | YBPOPQHIXMZPPD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|