C14H23N3O4 — CID 54819983
propyl 2-[3-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-2-yl]acetate (PubChem CID 54819983) has the molecular formula C14H23N3O4 and a molecular weight of 297.35 g/mol. Its IUPAC name is propyl 2-[3-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-2-yl]acetate.
| Compound Name | propyl 2-[3-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54819983 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | propyl 2-[3-oxo-1-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-2-yl]acetate |
| SMILES | C=CCNC(=O)CN1CCNC(=O)C1CC(=O)OCCC |
| InChI | InChI=1S/C14H23N3O4/c1-3-5-15-12(18)10-17-7-6-16-14(20)11(17)9-13(19)21-8-4-2/h3,11H,1,4-10H2,2H3,(H,15,18)(H,16,20) |
| InChIKey | WMEOGLPUOMOQEB-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|