C26H33N3O4 — CID 54821563
N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide (PubChem CID 54821563) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide.
| Compound Name | N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54821563 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide |
| SMILES | O=C(CNc1ccc(OCC2CCCO2)cc1)Nc1cccc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C26H33N3O4/c30-25(18-27-21-10-12-23(13-11-21)33-19-24-9-6-16-32-24)28-22-8-5-7-20(17-22)26(31)29-14-3-1-2-4-15-29/h5,7-8,10-13,17,24,27H,1-4,6,9,14-16,18-19H2,(H,28,30) |
| InChIKey | ISFCCRGPWHHJDT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|