C25H31N3O4 — CID 54843525
N-[4-(oxolan-2-ylmethoxy)phenyl]-2-[3-(piperidine-1-carbonyl)anilino]acetamide (PubChem CID 54843525) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[4-(oxolan-2-ylmethoxy)phenyl]-2-[3-(piperidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-[4-(oxolan-2-ylmethoxy)phenyl]-2-[3-(piperidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 54843525 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[4-(oxolan-2-ylmethoxy)phenyl]-2-[3-(piperidine-1-carbonyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(=O)N2CCCCC2)c1)Nc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H31N3O4/c29-24(27-20-9-11-22(12-10-20)32-18-23-8-5-15-31-23)17-26-21-7-4-6-19(16-21)25(30)28-13-2-1-3-14-28/h4,6-7,9-12,16,23,26H,1-3,5,8,13-15,17-18H2,(H,27,29) |
| InChIKey | KSHZUXBFYCMJBO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |