C21H27N3O3 — CID 54823757
N-[4-[acetyl(methyl)amino]phenyl]-2-[3-(2-methylpropoxy)anilino]acetamide (PubChem CID 54823757) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[4-[acetyl(methyl)amino]phenyl]-2-[3-(2-methylpropoxy)anilino]acetamide.
| Compound Name | N-[4-[acetyl(methyl)amino]phenyl]-2-[3-(2-methylpropoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54823757 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[4-[acetyl(methyl)amino]phenyl]-2-[3-(2-methylpropoxy)anilino]acetamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=O)CNc2cccc(OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-15(2)14-27-20-7-5-6-18(12-20)22-13-21(26)23-17-8-10-19(11-9-17)24(4)16(3)25/h5-12,15,22H,13-14H2,1-4H3,(H,23,26) |
| InChIKey | LDBKIEWBEZGJHT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |