C27H31N3O3 — CID 54823938
N-butan-2-yl-4-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]benzamide (PubChem CID 54823938) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-butan-2-yl-4-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]benzamide.
| Compound Name | N-butan-2-yl-4-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54823938 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-butan-2-yl-4-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(NC(=O)CNc2ccc(OCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H31N3O3/c1-3-20(2)29-27(32)22-9-11-24(12-10-22)30-26(31)19-28-23-13-15-25(16-14-23)33-18-17-21-7-5-4-6-8-21/h4-16,20,28H,3,17-19H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | LADQLBJCPVZTPI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|