About 1-iodo-1-methylthiolane
1-iodo-1-methylthiolane (PubChem CID 548240) has the molecular formula C5H11IS
and a molecular weight of 230.11 g/mol. Its IUPAC name is 1-iodo-1-methylthiolane.
Molecular Properties
| Compound Name | 1-iodo-1-methylthiolane |
| PubChem CID | 548240 |
| Molecular Formula | C5H11IS |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 1-iodo-1-methylthiolane |
| SMILES | CS1(I)CCCC1 |
| InChI | InChI=1S/C5H11IS/c1-7(6)4-2-3-5-7/h2-5H2,1H3 |
| InChIKey | ZLWGNHDBDXJTQR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-1-methylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-1-methylthiolane?
The IUPAC name of 1-iodo-1-methylthiolane (CID 548240) is 1-iodo-1-methylthiolane.
What is the SMILES notation for 1-iodo-1-methylthiolane?
The canonical SMILES for 1-iodo-1-methylthiolane is CS1(I)CCCC1.
What is the InChIKey of 1-iodo-1-methylthiolane?
The InChIKey is ZLWGNHDBDXJTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11IS/c1-7(6)4-2-3-5-7/h2-5H2,1H3.
What are the key properties of 1-iodo-1-methylthiolane?
1-iodo-1-methylthiolane has a molecular weight of 230.11 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-1-methylthiolane is sourced from PubChem (CID 548240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).