C25H28N2O3 — CID 54824046
2-[2-(2-methylpropoxy)anilino]-N-(4-phenylmethoxyphenyl)acetamide (PubChem CID 54824046) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[2-(2-methylpropoxy)anilino]-N-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | 2-[2-(2-methylpropoxy)anilino]-N-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54824046 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[2-(2-methylpropoxy)anilino]-N-(4-phenylmethoxyphenyl)acetamide |
| SMILES | CC(C)COc1ccccc1NCC(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-19(2)17-30-24-11-7-6-10-23(24)26-16-25(28)27-21-12-14-22(15-13-21)29-18-20-8-4-3-5-9-20/h3-15,19,26H,16-18H2,1-2H3,(H,27,28) |
| InChIKey | ZITHAZBLOCKLPM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |