C23H32N2O4 — CID 54824535
N-[2-(2-ethoxyethoxy)phenyl]-2-[3-(3-methylbutoxy)anilino]acetamide (PubChem CID 54824535) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[2-(2-ethoxyethoxy)phenyl]-2-[3-(3-methylbutoxy)anilino]acetamide.
| Compound Name | N-[2-(2-ethoxyethoxy)phenyl]-2-[3-(3-methylbutoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54824535 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[2-(2-ethoxyethoxy)phenyl]-2-[3-(3-methylbutoxy)anilino]acetamide |
| SMILES | CCOCCOc1ccccc1NC(=O)CNc1cccc(OCCC(C)C)c1 |
| InChI | InChI=1S/C23H32N2O4/c1-4-27-14-15-29-22-11-6-5-10-21(22)25-23(26)17-24-19-8-7-9-20(16-19)28-13-12-18(2)3/h5-11,16,18,24H,4,12-15,17H2,1-3H3,(H,25,26) |
| InChIKey | RCTWMMHUFIKRCS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|