C30H35N3O3 — CID 54825406
N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide (PubChem CID 54825406) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide.
| Compound Name | N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54825406 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-[3-(azepane-1-carbonyl)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide |
| SMILES | O=C(CNc1ccc(OCCCc2ccccc2)cc1)Nc1cccc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C30H35N3O3/c34-29(32-27-14-8-13-25(22-27)30(35)33-19-6-1-2-7-20-33)23-31-26-15-17-28(18-16-26)36-21-9-12-24-10-4-3-5-11-24/h3-5,8,10-11,13-18,22,31H,1-2,6-7,9,12,19-21,23H2,(H,32,34) |
| InChIKey | HEICWQCYFJEMFI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|