C20H23N3O3 — CID 54826616
N-[3-[[2-(3-prop-2-enoxyanilino)acetyl]amino]phenyl]propanamide (PubChem CID 54826616) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[3-[[2-(3-prop-2-enoxyanilino)acetyl]amino]phenyl]propanamide.
| Compound Name | N-[3-[[2-(3-prop-2-enoxyanilino)acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54826616 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[3-[[2-(3-prop-2-enoxyanilino)acetyl]amino]phenyl]propanamide |
| SMILES | C=CCOc1cccc(NCC(=O)Nc2cccc(NC(=O)CC)c2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-3-11-26-18-10-6-7-15(13-18)21-14-20(25)23-17-9-5-8-16(12-17)22-19(24)4-2/h3,5-10,12-13,21H,1,4,11,14H2,2H3,(H,22,24)(H,23,25) |
| InChIKey | YMSCRJDRIDYVMF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|