C22H28N2O4 — CID 54829439
2-[2-(oxolan-2-ylmethoxy)anilino]-N-(3-propoxyphenyl)acetamide (PubChem CID 54829439) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[2-(oxolan-2-ylmethoxy)anilino]-N-(3-propoxyphenyl)acetamide.
| Compound Name | 2-[2-(oxolan-2-ylmethoxy)anilino]-N-(3-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54829439 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[2-(oxolan-2-ylmethoxy)anilino]-N-(3-propoxyphenyl)acetamide |
| SMILES | CCCOc1cccc(NC(=O)CNc2ccccc2OCC2CCCO2)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-2-12-26-18-8-5-7-17(14-18)24-22(25)15-23-20-10-3-4-11-21(20)28-16-19-9-6-13-27-19/h3-5,7-8,10-11,14,19,23H,2,6,9,12-13,15-16H2,1H3,(H,24,25) |
| InChIKey | UTPBOYNMNTXUSE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |