C28H31N3O4 — CID 54829542
N-[3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]phenyl]-3-phenylpropanamide (PubChem CID 54829542) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]phenyl]-3-phenylpropanamide.
| Compound Name | N-[3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54829542 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1cccc(NC(=O)CNc2ccccc2OCC2CCCO2)c1 |
| InChI | InChI=1S/C28H31N3O4/c32-27(16-15-21-8-2-1-3-9-21)30-22-10-6-11-23(18-22)31-28(33)19-29-25-13-4-5-14-26(25)35-20-24-12-7-17-34-24/h1-6,8-11,13-14,18,24,29H,7,12,15-17,19-20H2,(H,30,32)(H,31,33) |
| InChIKey | ITLZMAXVOOXSHI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |