C28H31N3O4 — CID 54829445
3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54829445) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54829445 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(NC(=O)CNc2ccccc2OCC2CCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O4/c1-20(21-9-3-2-4-10-21)30-28(33)22-11-7-12-23(17-22)31-27(32)18-29-25-14-5-6-15-26(25)35-19-24-13-8-16-34-24/h2-7,9-12,14-15,17,20,24,29H,8,13,16,18-19H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | STKCQUBEITUMGH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |