C16H24ClN3O3 — CID 54831420
N-[4-chloro-3-[[2-(3-methoxypropylamino)-2-oxoethyl]amino]phenyl]butanamide (PubChem CID 54831420) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is N-[4-chloro-3-[[2-(3-methoxypropylamino)-2-oxoethyl]amino]phenyl]butanamide.
| Compound Name | N-[4-chloro-3-[[2-(3-methoxypropylamino)-2-oxoethyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54831420 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[4-chloro-3-[[2-(3-methoxypropylamino)-2-oxoethyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NCC(=O)NCCCOC)c1 |
| InChI | InChI=1S/C16H24ClN3O3/c1-3-5-15(21)20-12-6-7-13(17)14(10-12)19-11-16(22)18-8-4-9-23-2/h6-7,10,19H,3-5,8-9,11H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | KDWSRVJYTRHIFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|