C24H30N4O3 — CID 54832046
N-butyl-4-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide (PubChem CID 54832046) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-butyl-4-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide.
| Compound Name | N-butyl-4-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54832046 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-butyl-4-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccc(NCC(=O)Nc2cccc(C(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-2-3-13-25-23(30)18-9-11-20(12-10-18)26-17-22(29)27-21-8-6-7-19(16-21)24(31)28-14-4-5-15-28/h6-12,16,26H,2-5,13-15,17H2,1H3,(H,25,30)(H,27,29) |
| InChIKey | NFSZNYMJEZUKFQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|