C26H34N4O3 — CID 54833542
N-butyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54833542) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-butyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-butyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54833542 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N-butyl-3-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1cccc(NCC(=O)Nc2ccc(C(=O)N3CCC(C)CC3)cc2)c1 |
| InChI | InChI=1S/C26H34N4O3/c1-3-4-14-27-25(32)21-6-5-7-23(17-21)28-18-24(31)29-22-10-8-20(9-11-22)26(33)30-15-12-19(2)13-16-30/h5-11,17,19,28H,3-4,12-16,18H2,1-2H3,(H,27,32)(H,29,31) |
| InChIKey | VKBZHHGMSKNTQR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|