C23H30N4O3 — CID 54833387
3-[[2-[4-[3-(dimethylamino)-3-oxopropyl]anilino]-2-oxoethyl]amino]-N-propan-2-ylbenzamide (PubChem CID 54833387) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[[2-[4-[3-(dimethylamino)-3-oxopropyl]anilino]-2-oxoethyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 3-[[2-[4-[3-(dimethylamino)-3-oxopropyl]anilino]-2-oxoethyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 54833387 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-[[2-[4-[3-(dimethylamino)-3-oxopropyl]anilino]-2-oxoethyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cccc(NCC(=O)Nc2ccc(CCC(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-16(2)25-23(30)18-6-5-7-20(14-18)24-15-21(28)26-19-11-8-17(9-12-19)10-13-22(29)27(3)4/h5-9,11-12,14,16,24H,10,13,15H2,1-4H3,(H,25,30)(H,26,28) |
| InChIKey | CONOSUKDMCWOGN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |