C28H32N4O3 — CID 54845526
4-[[2-[3-[3-(dimethylamino)-3-oxopropyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54845526) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 4-[[2-[3-[3-(dimethylamino)-3-oxopropyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[[2-[3-[3-(dimethylamino)-3-oxopropyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54845526 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 4-[[2-[3-[3-(dimethylamino)-3-oxopropyl]anilino]acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(NC(=O)CNc2cccc(CCC(=O)N(C)C)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O3/c1-20(22-9-5-4-6-10-22)30-28(35)23-13-15-24(16-14-23)31-26(33)19-29-25-11-7-8-21(18-25)12-17-27(34)32(2)3/h4-11,13-16,18,20,29H,12,17,19H2,1-3H3,(H,30,35)(H,31,33) |
| InChIKey | UVISCTZKSKZKAN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |