C12H16F7NO3S — CID 548343
propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate (PubChem CID 548343) has the molecular formula C12H16F7NO3S and a molecular weight of 387.32 g/mol. Its IUPAC name is propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate.
| Compound Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 548343 |
| Molecular Formula | C12H16F7NO3S |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
| SMILES | CCCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F7NO3S/c1-3-5-23-8(21)7(4-6-24-2)20-9(22)10(13,14)11(15,16)12(17,18)19/h7H,3-6H2,1-2H3,(H,20,22) |
| InChIKey | DXEDYBBAJBCCRO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|