C22H29N3O2 — CID 54834460
N-butan-2-yl-4-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]benzamide (PubChem CID 54834460) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-butan-2-yl-4-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]benzamide.
| Compound Name | N-butan-2-yl-4-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834460 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-butan-2-yl-4-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(NCC(=O)Nc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-6-17(5)24-22(27)18-7-9-19(10-8-18)23-13-20(26)25-21-15(3)11-14(2)12-16(21)4/h7-12,17,23H,6,13H2,1-5H3,(H,24,27)(H,25,26) |
| InChIKey | RTHMYZPBJLOFMK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |