C19H29N3O2 — CID 54835140
2-[4-(azepane-1-carbonyl)anilino]-N,N-diethylacetamide (PubChem CID 54835140) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-[4-(azepane-1-carbonyl)anilino]-N,N-diethylacetamide.
| Compound Name | 2-[4-(azepane-1-carbonyl)anilino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 54835140 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2-[4-(azepane-1-carbonyl)anilino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNc1ccc(C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H29N3O2/c1-3-21(4-2)18(23)15-20-17-11-9-16(10-12-17)19(24)22-13-7-5-6-8-14-22/h9-12,20H,3-8,13-15H2,1-2H3 |
| InChIKey | XEAXFPKWDLYNML-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |