C22H23N3O4 — CID 54837825
N-(furan-2-ylmethyl)-3-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]benzamide (PubChem CID 54837825) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54837825 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]benzamide |
| SMILES | COc1ccc(CNCC(=O)Nc2cccc(C(=O)NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-28-19-9-7-16(8-10-19)13-23-15-21(26)25-18-5-2-4-17(12-18)22(27)24-14-20-6-3-11-29-20/h2-12,23H,13-15H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | VWTYUPAGQXXBMV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |