C7H5Br2NO2 — CID 548439
2,4-dibromo-6-(hydroxyiminomethyl)phenol (PubChem CID 548439) has the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. Its IUPAC name is 2,4-dibromo-6-(hydroxyiminomethyl)phenol.
| Compound Name | 2,4-dibromo-6-(hydroxyiminomethyl)phenol |
|---|---|
| PubChem CID | 548439 |
| Molecular Formula | C7H5Br2NO2 |
| Molecular Weight | 294.93 g/mol |
| Exact Mass | 292.87 |
| IUPAC Name | 2,4-dibromo-6-(hydroxyiminomethyl)phenol |
| SMILES | ON=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C7H5Br2NO2/c8-5-1-4(3-10-12)7(11)6(9)2-5/h1-3,11-12H |
| InChIKey | LRNICNSWROUZCF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.93 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|