C8H7Br2N3O3 — CID 135507635
1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea (PubChem CID 135507635) has the molecular formula C8H7Br2N3O3 and a molecular weight of 352.97 g/mol. Its IUPAC name is 1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea.
| Compound Name | 1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea |
|---|---|
| PubChem CID | 135507635 |
| Molecular Formula | C8H7Br2N3O3 |
| Molecular Weight | 352.97 g/mol |
| Exact Mass | 350.89 |
| IUPAC Name | 1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea |
| SMILES | O=C(NO)N/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C8H7Br2N3O3/c9-5-1-4(7(14)6(10)2-5)3-11-12-8(15)13-16/h1-3,14,16H,(H2,12,13,15)/b11-3+ |
| InChIKey | YPCPTPHCVFVQLH-QDEBKDIKSA-N |
| XLogP | 1.94 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.97 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|