C8H7Br2N3OS — CID 135408771
[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 135408771) has the molecular formula C8H7Br2N3OS and a molecular weight of 353.04 g/mol. Its IUPAC name is [(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | [(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135408771 |
| Molecular Formula | C8H7Br2N3OS |
| Molecular Weight | 353.04 g/mol |
| Exact Mass | 350.87 |
| IUPAC Name | [(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C8H7Br2N3OS/c9-5-1-4(3-12-13-8(11)15)7(14)6(10)2-5/h1-3,14H,(H3,11,13,15)/b12-3+ |
| InChIKey | KOUSSFCOFUJIJA-KGVSQERTSA-N |
| XLogP | 2.08 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.04 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|