C13H13ClN2O2 — CID 54850467
3-[2-(2-chlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-carboxylic acid (PubChem CID 54850467) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 3-[2-(2-chlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 54850467 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethyl]-5-methyl-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1[nH]nc(CCc2ccccc2Cl)c1C(=O)O |
| InChI | InChI=1S/C13H13ClN2O2/c1-8-12(13(17)18)11(16-15-8)7-6-9-4-2-3-5-10(9)14/h2-5H,6-7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | IQBYRTQYCDFBIN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |