C15H19N3O2 — CID 19847535
3-(2,6-diethylanilino)-5-methyl-1H-pyrazole-4-carboxylic acid (PubChem CID 19847535) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-(2,6-diethylanilino)-5-methyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 3-(2,6-diethylanilino)-5-methyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19847535 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-(2,6-diethylanilino)-5-methyl-1H-pyrazole-4-carboxylic acid |
| SMILES | CCc1cccc(CC)c1Nc1n[nH]c(C)c1C(=O)O |
| InChI | InChI=1S/C15H19N3O2/c1-4-10-7-6-8-11(5-2)13(10)16-14-12(15(19)20)9(3)17-18-14/h6-8H,4-5H2,1-3H3,(H,19,20)(H2,16,17,18) |
| InChIKey | MABLPQXIGXYYBR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |