C9H10N2O2 — CID 54851051
[3-(furan-2-yl)-5-methyl-1H-pyrazol-4-yl]methanol (PubChem CID 54851051) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is [3-(furan-2-yl)-5-methyl-1H-pyrazol-4-yl]methanol.
| Compound Name | [3-(furan-2-yl)-5-methyl-1H-pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 54851051 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | [3-(furan-2-yl)-5-methyl-1H-pyrazol-4-yl]methanol |
| SMILES | Cc1[nH]nc(-c2ccco2)c1CO |
| InChI | InChI=1S/C9H10N2O2/c1-6-7(5-12)9(11-10-6)8-3-2-4-13-8/h2-4,12H,5H2,1H3,(H,10,11) |
| InChIKey | PUFVUFYIMIJWSW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |