C19H20N4O2 — CID 54851249
5-methyl-3-[1-(4-phenylphenoxy)ethyl]-1H-pyrazole-4-carbohydrazide (PubChem CID 54851249) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-methyl-3-[1-(4-phenylphenoxy)ethyl]-1H-pyrazole-4-carbohydrazide.
| Compound Name | 5-methyl-3-[1-(4-phenylphenoxy)ethyl]-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 54851249 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-methyl-3-[1-(4-phenylphenoxy)ethyl]-1H-pyrazole-4-carbohydrazide |
| SMILES | Cc1[nH]nc(C(C)Oc2ccc(-c3ccccc3)cc2)c1C(=O)NN |
| InChI | InChI=1S/C19H20N4O2/c1-12-17(19(24)21-20)18(23-22-12)13(2)25-16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11,13H,20H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | HTGMYFRNPJGZQO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|