C17H21N3O4 — CID 54851650
ethyl 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxylate (PubChem CID 54851650) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 54851650 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | ethyl 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(N)nc1-c1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C17H21N3O4/c1-4-23-16(21)14-11(2)19-17(18)20-15(14)12-5-7-13(8-6-12)24-10-9-22-3/h5-8H,4,9-10H2,1-3H3,(H2,18,19,20) |
| InChIKey | UFYCQEKOHDXJQT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|