C18H23N3O3 — CID 54851374
ethyl 2-amino-4-methyl-6-[4-(2-methylpropoxy)phenyl]pyrimidine-5-carboxylate (PubChem CID 54851374) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 2-amino-4-methyl-6-[4-(2-methylpropoxy)phenyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-amino-4-methyl-6-[4-(2-methylpropoxy)phenyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 54851374 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | ethyl 2-amino-4-methyl-6-[4-(2-methylpropoxy)phenyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(N)nc1-c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-5-23-17(22)15-12(4)20-18(19)21-16(15)13-6-8-14(9-7-13)24-10-11(2)3/h6-9,11H,5,10H2,1-4H3,(H2,19,20,21) |
| InChIKey | ADBQJLOVCUGQGL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |