C14H17N5O3 — CID 54851651
2-amino-6-[2-(2-methoxyethoxy)phenyl]pyrimidine-4-carbohydrazide (PubChem CID 54851651) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-amino-6-[2-(2-methoxyethoxy)phenyl]pyrimidine-4-carbohydrazide.
| Compound Name | 2-amino-6-[2-(2-methoxyethoxy)phenyl]pyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 54851651 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-amino-6-[2-(2-methoxyethoxy)phenyl]pyrimidine-4-carbohydrazide |
| SMILES | COCCOc1ccccc1-c1cc(C(=O)NN)nc(N)n1 |
| InChI | InChI=1S/C14H17N5O3/c1-21-6-7-22-12-5-3-2-4-9(12)10-8-11(13(20)19-16)18-14(15)17-10/h2-5,8H,6-7,16H2,1H3,(H,19,20)(H2,15,17,18) |
| InChIKey | LFZLMFQPUCAVIC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|