C23H29N3O2 — CID 54852118
4-[[3-(2-heptoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline (PubChem CID 54852118) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-[[3-(2-heptoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline.
| Compound Name | 4-[[3-(2-heptoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline |
|---|---|
| PubChem CID | 54852118 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-[[3-(2-heptoxyphenyl)-1H-pyrazol-5-yl]methoxy]aniline |
| SMILES | CCCCCCCOc1ccccc1-c1cc(COc2ccc(N)cc2)[nH]n1 |
| InChI | InChI=1S/C23H29N3O2/c1-2-3-4-5-8-15-27-23-10-7-6-9-21(23)22-16-19(25-26-22)17-28-20-13-11-18(24)12-14-20/h6-7,9-14,16H,2-5,8,15,17,24H2,1H3,(H,25,26) |
| InChIKey | HJNQROACNITDQE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|